![3-Iodoimidazo[1,2-a]pyridine (CAS: 307503-19-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0684454.png "3-Iodoimidazo[1,2-a]pyridine chemical structure")
3-Iodoimidazo[1,2-a]pyridine
Catalog No: FT-0684454
CAS No: 307503-19-1
- Chemical Name: 3-Iodoimidazo[1,2-a]pyridine
- Molecular Formula: C7H5IN2
- Molecular Weight: 244.03
- InChI Key: BPQZPYPWXGFNRU-UHFFFAOYSA-N
- InChI: InChI=1S/C7H5IN2/c8-6-5-9-7-3-1-2-4-10(6)7/h1-5H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 244.03200 |
| Density: | 2.015g/cm3 |
| CAS: | 307503-19-1 |
| Bolling_Point: | N/A |
| Product_Name: | 3-Iodoimidazo[1,2-a]pyridine |
| Melting_Point: | N/A |
| Flash_Point: | N/A |
| MF: | C7H5IN2 |
| Density: | 2.015g/cm3 |
|---|---|
| LogP: | 1.93890 |
| Refractive_Index: | 1.75 |
| FW: | 244.03200 |
| PSA: | 17.30000 |
| MF: | C7H5IN2 |
| Exact_Mass: | 243.95000 |
| Warning_Statement: | P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H315-H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
![2-[4-[(dimethylamino)methyl]phenyl]acetic acid (CAS: 99985-52-1) - Related Chemical Product](/static/img/prod_pic/FT-0737063.png "2-[4-[(dimethylamino)methyl]phenyl]acetic acid chemical structure")
![2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol (CAS: 99982-60-2) - Related Chemical Product](/static/img/prod_pic/FT-0749988.png "2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol chemical structure")
